C11H8Cl3N3O2 — CID 103544569
methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate (PubChem CID 103544569) has the molecular formula C11H8Cl3N3O2 and a molecular weight of 320.56 g/mol. Its IUPAC name is methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 103544569 |
| Molecular Formula | C11H8Cl3N3O2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate |
| SMILES | COC(=O)c1ncn(-c2cc(Cl)c(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C11H8Cl3N3O2/c1-19-11(18)9-10(15)17(4-16-9)8-3-6(13)5(12)2-7(8)14/h2-4H,15H2,1H3 |
| InChIKey | HBCPRKXILKICOD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|