About methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate
methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate (PubChem CID 103544569) has the molecular formula C11H8Cl3N3O2
and a molecular weight of 320.56 g/mol. Its IUPAC name is methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate |
| PubChem CID | 103544569 |
| Molecular Formula | C11H8Cl3N3O2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate |
| SMILES | COC(=O)c1ncn(-c2cc(Cl)c(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C11H8Cl3N3O2/c1-19-11(18)9-10(15)17(4-16-9)8-3-6(13)5(12)2-7(8)14/h2-4H,15H2,1H3 |
| InChIKey | HBCPRKXILKICOD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate?
The IUPAC name of methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate (CID 103544569) is methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate.
What is the SMILES notation for methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate?
The canonical SMILES for methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate is COC(=O)c1ncn(-c2cc(Cl)c(Cl)cc2Cl)c1N.
What is the InChIKey of methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate?
The InChIKey is HBCPRKXILKICOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl3N3O2/c1-19-11(18)9-10(15)17(4-16-9)8-3-6(13)5(12)2-7(8)14/h2-4H,15H2,1H3.
What are the key properties of methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate?
methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate has a molecular weight of 320.56 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-1-(2,4,5-trichlorophenyl)imidazole-4-carboxylate is sourced from PubChem (CID 103544569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).