About N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide
N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide (PubChem CID 1035470) has the molecular formula C23H23N3O6
and a molecular weight of 437.45 g/mol. Its IUPAC name is N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide |
| PubChem CID | 1035470 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2cccc(NC(=O)c3cc(OC)cc(OC)c3)n2)c1 |
| InChI | InChI=1S/C23H23N3O6/c1-29-16-8-14(9-17(12-16)30-2)22(27)25-20-6-5-7-21(24-20)26-23(28)15-10-18(31-3)13-19(11-15)32-4/h5-13H,1-4H3,(H2,24,25,26,27,28) |
| InChIKey | HLPGQLZRWOUVNI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide?
The IUPAC name of N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide (CID 1035470) is N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide.
What is the SMILES notation for N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide?
The canonical SMILES for N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide is COc1cc(OC)cc(C(=O)Nc2cccc(NC(=O)c3cc(OC)cc(OC)c3)n2)c1.
What is the InChIKey of N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide?
The InChIKey is HLPGQLZRWOUVNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O6/c1-29-16-8-14(9-17(12-16)30-2)22(27)25-20-6-5-7-21(24-20)26-23(28)15-10-18(31-3)13-19(11-15)32-4/h5-13H,1-4H3,(H2,24,25,26,27,28).
What are the key properties of N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide?
N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide has a molecular weight of 437.45 g/mol, XLogP of 3.62, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-[(3,5-dimethoxybenzoyl)amino]-2-pyridinyl]-3,5-dimethoxybenzamide is sourced from PubChem (CID 1035470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).