C10H20BrNO — CID 10354714
trimethyl-[[(1S,3R,5R)-1-methyl-6-oxabicyclo[3.1.0]hexan-3-yl]methyl]azanium bromide (PubChem CID 10354714) has the molecular formula C10H20BrNO and a molecular weight of 250.18 g/mol. Its IUPAC name is trimethyl-[[(1S,3R,5R)-1-methyl-6-oxabicyclo[3.1.0]hexan-3-yl]methyl]azanium bromide.
| Compound Name | trimethyl-[[(1S,3R,5R)-1-methyl-6-oxabicyclo[3.1.0]hexan-3-yl]methyl]azanium bromide |
|---|---|
| PubChem CID | 10354714 |
| Molecular Formula | C10H20BrNO |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | trimethyl-[[(1S,3R,5R)-1-methyl-6-oxabicyclo[3.1.0]hexan-3-yl]methyl]azanium bromide |
| SMILES | C[C@]12C[C@H](C[N+](C)(C)C)C[C@H]1O2.[Br-] |
| InChI | InChI=1S/C10H20NO.BrH/c1-10-6-8(5-9(10)12-10)7-11(2,3)4;/h8-9H,5-7H2,1-4H3;1H/q+1;/p-1/t8-,9-,10+;/m1./s1 |
| InChIKey | HFPHRSSYDWRHQR-RIHXGJNQSA-M |
| XLogP | -1.74 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|