C12H12O5 — CID 103547942
(3S)-3-[(3-oxo-1-benzofuran-6-yl)oxy]butanoic acid (PubChem CID 103547942) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is (3S)-3-[(3-oxo-1-benzofuran-6-yl)oxy]butanoic acid.
| Compound Name | (3S)-3-[(3-oxo-1-benzofuran-6-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 103547942 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (3S)-3-[(3-oxo-1-benzofuran-6-yl)oxy]butanoic acid |
| SMILES | C[C@@H](CC(=O)O)Oc1ccc2c(c1)OCC2=O |
| InChI | InChI=1S/C12H12O5/c1-7(4-12(14)15)17-8-2-3-9-10(13)6-16-11(9)5-8/h2-3,5,7H,4,6H2,1H3,(H,14,15)/t7-/m0/s1 |
| InChIKey | BHZXDVCETBGKOQ-ZETCQYMHSA-N |
| XLogP | 1.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |