C11H12Br2O4 — CID 103548086
(3R)-3-(2,5-dibromo-4-methoxyphenoxy)butanoic acid (PubChem CID 103548086) has the molecular formula C11H12Br2O4 and a molecular weight of 368.02 g/mol. Its IUPAC name is (3R)-3-(2,5-dibromo-4-methoxyphenoxy)butanoic acid.
| Compound Name | (3R)-3-(2,5-dibromo-4-methoxyphenoxy)butanoic acid |
|---|---|
| PubChem CID | 103548086 |
| Molecular Formula | C11H12Br2O4 |
| Molecular Weight | 368.02 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | (3R)-3-(2,5-dibromo-4-methoxyphenoxy)butanoic acid |
| SMILES | COc1cc(Br)c(O[C@H](C)CC(=O)O)cc1Br |
| InChI | InChI=1S/C11H12Br2O4/c1-6(3-11(14)15)17-10-5-7(12)9(16-2)4-8(10)13/h4-6H,3H2,1-2H3,(H,14,15)/t6-/m1/s1 |
| InChIKey | LDCWBXOVMOXFJE-ZCFIWIBFSA-N |
| XLogP | 3.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.02 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |