C10H15N3O3 — CID 103548403
5-methyl-N-(morpholin-3-ylmethyl)-1,2-oxazole-4-carboxamide (PubChem CID 103548403) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 5-methyl-N-(morpholin-3-ylmethyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-methyl-N-(morpholin-3-ylmethyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 103548403 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 5-methyl-N-(morpholin-3-ylmethyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(=O)NCC1COCCN1 |
| InChI | InChI=1S/C10H15N3O3/c1-7-9(5-13-16-7)10(14)12-4-8-6-15-3-2-11-8/h5,8,11H,2-4,6H2,1H3,(H,12,14) |
| InChIKey | MZVZBZKFPMOQRP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |