C9H15F3N2O3 — CID 103548442
N-(morpholin-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103548442) has the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is N-(morpholin-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(morpholin-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103548442 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-(morpholin-3-ylmethyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COCC(F)(F)F)NCC1COCCN1 |
| InChI | InChI=1S/C9H15F3N2O3/c10-9(11,12)6-17-5-8(15)14-3-7-4-16-2-1-13-7/h7,13H,1-6H2,(H,14,15) |
| InChIKey | CEVRMWGUGJEWLJ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |