C14H10N2O3 — CID 10354942
3-(hydroxymethyl)-4-oxa-7,10-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-5-one (PubChem CID 10354942) has the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. Its IUPAC name is 3-(hydroxymethyl)-4-oxa-7,10-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-5-one.
| Compound Name | 3-(hydroxymethyl)-4-oxa-7,10-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-5-one |
|---|---|
| PubChem CID | 10354942 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3-(hydroxymethyl)-4-oxa-7,10-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-5-one |
| SMILES | O=C1OC(CO)c2c1ncc1[nH]c3ccccc3c21 |
| InChI | InChI=1S/C14H10N2O3/c17-6-10-12-11-7-3-1-2-4-8(7)16-9(11)5-15-13(12)14(18)19-10/h1-5,10,16-17H,6H2 |
| InChIKey | LEGQLTDMFNLUQJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |