3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid

C9H13F2NO3 — CID 103551037

IUPAC3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid
SMILESO=C(O)C1CCC(C(=O)NCC(F)F)C1
InChIInChI=1S/C9H13F2NO3/c10-7(11)4-12-8(13)5-1-2-6(3-5)9(14)15/h5-7H,1-4H2,(H,12,13)(H,14,15)
InChIKeyJIBKVXVQYRTOAM-UHFFFAOYSA-N
MW221.20 g/mol
LogP0.87
Rot. Bonds4

About 3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid

3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 103551037) has the molecular formula C9H13F2NO3 and a molecular weight of 221.20 g/mol. Its IUPAC name is 3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid
PubChem CID103551037
Molecular FormulaC9H13F2NO3
Molecular Weight221.20 g/mol
Exact Mass221.09
IUPAC Name3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid
SMILESO=C(O)C1CCC(C(=O)NCC(F)F)C1
InChIInChI=1S/C9H13F2NO3/c10-7(11)4-12-8(13)5-1-2-6(3-5)9(14)15/h5-7H,1-4H2,(H,12,13)(H,14,15)
InChIKeyJIBKVXVQYRTOAM-UHFFFAOYSA-N
XLogP0.87
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.20
LogP ≤ 50.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid?
The IUPAC name of 3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid (CID 103551037) is 3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid?
The canonical SMILES for 3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid is O=C(O)C1CCC(C(=O)NCC(F)F)C1.
What is the InChIKey of 3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid?
The InChIKey is JIBKVXVQYRTOAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO3/c10-7(11)4-12-8(13)5-1-2-6(3-5)9(14)15/h5-7H,1-4H2,(H,12,13)(H,14,15).
What are the key properties of 3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid?
3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid has a molecular weight of 221.20 g/mol, XLogP of 0.87, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethylcarbamoyl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 103551037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).