C12H18F3NO3 — CID 103551039
3-(5,5,5-trifluoropentylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 103551039) has the molecular formula C12H18F3NO3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 3-(5,5,5-trifluoropentylcarbamoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(5,5,5-trifluoropentylcarbamoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103551039 |
| Molecular Formula | C12H18F3NO3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-(5,5,5-trifluoropentylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NCCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H18F3NO3/c13-12(14,15)5-1-2-6-16-10(17)8-3-4-9(7-8)11(18)19/h8-9H,1-7H2,(H,16,17)(H,18,19) |
| InChIKey | BADJTOKAKRGZMY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|