C11H16F3NO3 — CID 103551040
3-(4,4,4-trifluorobutylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 103551040) has the molecular formula C11H16F3NO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is 3-(4,4,4-trifluorobutylcarbamoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(4,4,4-trifluorobutylcarbamoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103551040 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-(4,4,4-trifluorobutylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H16F3NO3/c12-11(13,14)4-1-5-15-9(16)7-2-3-8(6-7)10(17)18/h7-8H,1-6H2,(H,15,16)(H,17,18) |
| InChIKey | DMLADINGXQRETB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|