About 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid
3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 103551117) has the molecular formula C13H18N2O3S
and a molecular weight of 282.36 g/mol. Its IUPAC name is 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid |
| PubChem CID | 103551117 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | Cc1cnc(C(C)NC(=O)C2CCC(C(=O)O)C2)s1 |
| InChI | InChI=1S/C13H18N2O3S/c1-7-6-14-12(19-7)8(2)15-11(16)9-3-4-10(5-9)13(17)18/h6,8-10H,3-5H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | OEKSQJLUNLHOME-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid?
The IUPAC name of 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid (CID 103551117) is 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid.
What is the SMILES notation for 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid?
The canonical SMILES for 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid is Cc1cnc(C(C)NC(=O)C2CCC(C(=O)O)C2)s1.
What is the InChIKey of 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid?
The InChIKey is OEKSQJLUNLHOME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3S/c1-7-6-14-12(19-7)8(2)15-11(16)9-3-4-10(5-9)13(17)18/h6,8-10H,3-5H2,1-2H3,(H,15,16)(H,17,18).
What are the key properties of 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid?
3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid has a molecular weight of 282.36 g/mol, XLogP of 2.13, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(5-methyl-1,3-thiazol-2-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 103551117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).