C14H14F2O4 — CID 103551753
3-(2,6-difluoro-4-methoxybenzoyl)cyclopentane-1-carboxylic acid (PubChem CID 103551753) has the molecular formula C14H14F2O4 and a molecular weight of 284.26 g/mol. Its IUPAC name is 3-(2,6-difluoro-4-methoxybenzoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(2,6-difluoro-4-methoxybenzoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103551753 |
| Molecular Formula | C14H14F2O4 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3-(2,6-difluoro-4-methoxybenzoyl)cyclopentane-1-carboxylic acid |
| SMILES | COc1cc(F)c(C(=O)C2CCC(C(=O)O)C2)c(F)c1 |
| InChI | InChI=1S/C14H14F2O4/c1-20-9-5-10(15)12(11(16)6-9)13(17)7-2-3-8(4-7)14(18)19/h5-8H,2-4H2,1H3,(H,18,19) |
| InChIKey | JZVLYSXOBXZZNV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |