C15H14N2O4 — CID 103552419
(E)-3-[6-(2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-2-pyridinyl]prop-2-enoic acid (PubChem CID 103552419) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is (E)-3-[6-(2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-2-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103552419 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (E)-3-[6-(2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-2-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(N2C(=O)C3CCC(C3)C2=O)n1 |
| InChI | InChI=1S/C15H14N2O4/c18-13(19)7-6-11-2-1-3-12(16-11)17-14(20)9-4-5-10(8-9)15(17)21/h1-3,6-7,9-10H,4-5,8H2,(H,18,19)/b7-6+ |
| InChIKey | NZFZZSMHDDMQKV-VOTSOKGWSA-N |
| XLogP | 1.47 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|