C18H16N2 — CID 10355252
(1R)-2-methyl-2,10-diazapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-5(18),6,8(17),9,11,13,15-heptaene (PubChem CID 10355252) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (1R)-2-methyl-2,10-diazapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-5(18),6,8(17),9,11,13,15-heptaene.
| Compound Name | (1R)-2-methyl-2,10-diazapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-5(18),6,8(17),9,11,13,15-heptaene |
|---|---|
| PubChem CID | 10355252 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (1R)-2-methyl-2,10-diazapentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-5(18),6,8(17),9,11,13,15-heptaene |
| SMILES | CN1CCc2ccc3cnc4cccc5c4c3c2[C@H]1C5 |
| InChI | InChI=1S/C18H16N2/c1-20-8-7-11-5-6-13-10-19-14-4-2-3-12-9-15(20)17(11)18(13)16(12)14/h2-6,10,15H,7-9H2,1H3/t15-/m1/s1 |
| InChIKey | XKOOJEWWQSZWFX-OAHLLOKOSA-N |
| XLogP | 3.47 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|