C12H15ClF4N4 — CID 103553073
4-chloro-5-fluoro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzene-1,3-diamine (PubChem CID 103553073) has the molecular formula C12H15ClF4N4 and a molecular weight of 326.73 g/mol. Its IUPAC name is 4-chloro-5-fluoro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzene-1,3-diamine.
| Compound Name | 4-chloro-5-fluoro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 103553073 |
| Molecular Formula | C12H15ClF4N4 |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-chloro-5-fluoro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzene-1,3-diamine |
| SMILES | Nc1cc(N)c(N2CCN(CC(F)(F)F)CC2)c(F)c1Cl |
| InChI | InChI=1S/C12H15ClF4N4/c13-9-7(18)5-8(19)11(10(9)14)21-3-1-20(2-4-21)6-12(15,16)17/h5H,1-4,6,18-19H2 |
| InChIKey | CIXQKFBMXZVGGG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|