About 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine
5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine (PubChem CID 103553239) has the molecular formula C12H15ClFN3
and a molecular weight of 255.72 g/mol. Its IUPAC name is 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine.
Molecular Properties
| Compound Name | 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine |
| PubChem CID | 103553239 |
| Molecular Formula | C12H15ClFN3 |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine |
| SMILES | Nc1cc(N)c(NC2CC=CCC2)c(F)c1Cl |
| InChI | InChI=1S/C12H15ClFN3/c13-10-8(15)6-9(16)12(11(10)14)17-7-4-2-1-3-5-7/h1-2,6-7,17H,3-5,15-16H2 |
| InChIKey | VVJAAESZPAOPFZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine?
The IUPAC name of 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine (CID 103553239) is 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine.
What is the SMILES notation for 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine?
The canonical SMILES for 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine is Nc1cc(N)c(NC2CC=CCC2)c(F)c1Cl.
What is the InChIKey of 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine?
The InChIKey is VVJAAESZPAOPFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClFN3/c13-10-8(15)6-9(16)12(11(10)14)17-7-4-2-1-3-5-7/h1-2,6-7,17H,3-5,15-16H2.
What are the key properties of 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine?
5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine has a molecular weight of 255.72 g/mol, XLogP of 3.16, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-N-cyclohex-3-en-1-yl-6-fluorobenzene-1,2,4-triamine is sourced from PubChem (CID 103553239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).