C15H21NO3 — CID 10355391
N-[3-(2,3-dihydro-1,4-benzodioxin-5-yl)propyl]butanamide (PubChem CID 10355391) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-[3-(2,3-dihydro-1,4-benzodioxin-5-yl)propyl]butanamide.
| Compound Name | N-[3-(2,3-dihydro-1,4-benzodioxin-5-yl)propyl]butanamide |
|---|---|
| PubChem CID | 10355391 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-[3-(2,3-dihydro-1,4-benzodioxin-5-yl)propyl]butanamide |
| SMILES | CCCC(=O)NCCCc1cccc2c1OCCO2 |
| InChI | InChI=1S/C15H21NO3/c1-2-5-14(17)16-9-4-7-12-6-3-8-13-15(12)19-11-10-18-13/h3,6,8H,2,4-5,7,9-11H2,1H3,(H,16,17) |
| InChIKey | DVPDMESGNBGBDB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|