C17H34N2O3 — CID 103554338
tert-butyl 3-(1-aminooctyl)morpholine-4-carboxylate (PubChem CID 103554338) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is tert-butyl 3-(1-aminooctyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-(1-aminooctyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 103554338 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | tert-butyl 3-(1-aminooctyl)morpholine-4-carboxylate |
| SMILES | CCCCCCCC(N)C1COCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H34N2O3/c1-5-6-7-8-9-10-14(18)15-13-21-12-11-19(15)16(20)22-17(2,3)4/h14-15H,5-13,18H2,1-4H3 |
| InChIKey | BJSWESHKYQEMPF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|