C12H18N4O4 — CID 103554699
1-(2,3-dimethyl-5-nitroimidazol-4-yl)-4-methylpiperidine-2-carboxylic acid (PubChem CID 103554699) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-(2,3-dimethyl-5-nitroimidazol-4-yl)-4-methylpiperidine-2-carboxylic acid.
| Compound Name | 1-(2,3-dimethyl-5-nitroimidazol-4-yl)-4-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 103554699 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-(2,3-dimethyl-5-nitroimidazol-4-yl)-4-methylpiperidine-2-carboxylic acid |
| SMILES | Cc1nc([N+](=O)[O-])c(N2CCC(C)CC2C(=O)O)n1C |
| InChI | InChI=1S/C12H18N4O4/c1-7-4-5-15(9(6-7)12(17)18)11-10(16(19)20)13-8(2)14(11)3/h7,9H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | CBWZNUPBCFWJKU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|