About 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole
4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole (PubChem CID 103555119) has the molecular formula C10H12BrN5O2
and a molecular weight of 314.14 g/mol. Its IUPAC name is 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole |
| PubChem CID | 103555119 |
| Molecular Formula | C10H12BrN5O2 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole |
| SMILES | Cc1nn(-c2c([N+](=O)[O-])nc(C)n2C)c(C)c1Br |
| InChI | InChI=1S/C10H12BrN5O2/c1-5-8(11)6(2)15(13-5)10-9(16(17)18)12-7(3)14(10)4/h1-4H3 |
| InChIKey | LILGTRIBOAJTPC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole?
The IUPAC name of 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole (CID 103555119) is 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole.
What is the SMILES notation for 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole?
The canonical SMILES for 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole is Cc1nn(-c2c([N+](=O)[O-])nc(C)n2C)c(C)c1Br.
What is the InChIKey of 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole?
The InChIKey is LILGTRIBOAJTPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN5O2/c1-5-8(11)6(2)15(13-5)10-9(16(17)18)12-7(3)14(10)4/h1-4H3.
What are the key properties of 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole?
4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole has a molecular weight of 314.14 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(2,3-dimethyl-5-nitroimidazol-4-yl)-3,5-dimethylpyrazole is sourced from PubChem (CID 103555119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).