C14H18O5 — CID 10355542
(1aR,3aS,5E,7S,7aS)-3a,7-dihydroxy-2,2-dimethyl-5-(2-oxopropylidene)-1,1a,6,7-tetrahydrocyclopropa[c][1]benzofuran-4-one (PubChem CID 10355542) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (1aR,3aS,5E,7S,7aS)-3a,7-dihydroxy-2,2-dimethyl-5-(2-oxopropylidene)-1,1a,6,7-tetrahydrocyclopropa[c][1]benzofuran-4-one.
| Compound Name | (1aR,3aS,5E,7S,7aS)-3a,7-dihydroxy-2,2-dimethyl-5-(2-oxopropylidene)-1,1a,6,7-tetrahydrocyclopropa[c][1]benzofuran-4-one |
|---|---|
| PubChem CID | 10355542 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1aR,3aS,5E,7S,7aS)-3a,7-dihydroxy-2,2-dimethyl-5-(2-oxopropylidene)-1,1a,6,7-tetrahydrocyclopropa[c][1]benzofuran-4-one |
| SMILES | CC(=O)/C=C1\C[C@H](O)[C@]23C[C@H]2C(C)(C)O[C@]3(O)C1=O |
| InChI | InChI=1S/C14H18O5/c1-7(15)4-8-5-10(16)13-6-9(13)12(2,3)19-14(13,18)11(8)17/h4,9-10,16,18H,5-6H2,1-3H3/b8-4+/t9-,10-,13-,14+/m0/s1 |
| InChIKey | LKNPZQZUTUAUNZ-BFQYGXMCSA-N |
| XLogP | 0.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|