C14H17BrO3 — CID 103555951
1-(2-bromo-4-methoxyphenyl)-2-(1-methoxycyclobutyl)ethanone (PubChem CID 103555951) has the molecular formula C14H17BrO3 and a molecular weight of 313.19 g/mol. Its IUPAC name is 1-(2-bromo-4-methoxyphenyl)-2-(1-methoxycyclobutyl)ethanone.
| Compound Name | 1-(2-bromo-4-methoxyphenyl)-2-(1-methoxycyclobutyl)ethanone |
|---|---|
| PubChem CID | 103555951 |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 1-(2-bromo-4-methoxyphenyl)-2-(1-methoxycyclobutyl)ethanone |
| SMILES | COc1ccc(C(=O)CC2(OC)CCC2)c(Br)c1 |
| InChI | InChI=1S/C14H17BrO3/c1-17-10-4-5-11(12(15)8-10)13(16)9-14(18-2)6-3-7-14/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | LJXHQJVFTSHDFX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |