About methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate
methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate (PubChem CID 10355750) has the molecular formula C10H10N2O7
and a molecular weight of 270.20 g/mol. Its IUPAC name is methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate.
Molecular Properties
| Compound Name | methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate |
| PubChem CID | 10355750 |
| Molecular Formula | C10H10N2O7 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate |
| SMILES | COC(=O)Cc1cc(OC)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O7/c1-18-9-3-6(4-10(13)19-2)7(11(14)15)5-8(9)12(16)17/h3,5H,4H2,1-2H3 |
| InChIKey | VUZKGNRXESYCLF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate?
The IUPAC name of methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate (CID 10355750) is methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate.
What is the SMILES notation for methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate?
The canonical SMILES for methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate is COC(=O)Cc1cc(OC)c([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate?
The InChIKey is VUZKGNRXESYCLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O7/c1-18-9-3-6(4-10(13)19-2)7(11(14)15)5-8(9)12(16)17/h3,5H,4H2,1-2H3.
What are the key properties of methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate?
methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate has a molecular weight of 270.20 g/mol, XLogP of 1.23, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-methoxy-2,4-dinitrophenyl)acetate is sourced from PubChem (CID 10355750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).