C17H22FNO2 — CID 103559896
N-ethyl-1-(7-fluoro-1-benzofuran-2-yl)-2-(1-methoxycyclobutyl)ethanamine (PubChem CID 103559896) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is N-ethyl-1-(7-fluoro-1-benzofuran-2-yl)-2-(1-methoxycyclobutyl)ethanamine.
| Compound Name | N-ethyl-1-(7-fluoro-1-benzofuran-2-yl)-2-(1-methoxycyclobutyl)ethanamine |
|---|---|
| PubChem CID | 103559896 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-ethyl-1-(7-fluoro-1-benzofuran-2-yl)-2-(1-methoxycyclobutyl)ethanamine |
| SMILES | CCNC(CC1(OC)CCC1)c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C17H22FNO2/c1-3-19-14(11-17(20-2)8-5-9-17)15-10-12-6-4-7-13(18)16(12)21-15/h4,6-7,10,14,19H,3,5,8-9,11H2,1-2H3 |
| InChIKey | YDOVSIDRQGBVEG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |