About 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol
6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol (PubChem CID 10355999) has the molecular formula C16H34O3
and a molecular weight of 274.44 g/mol. Its IUPAC name is 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol.
Molecular Properties
| Compound Name | 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol |
| PubChem CID | 10355999 |
| Molecular Formula | C16H34O3 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol |
| SMILES | CC(C)(CO)CCCCOCCCCC(C)(C)CO |
| InChI | InChI=1S/C16H34O3/c1-15(2,13-17)9-5-7-11-19-12-8-6-10-16(3,4)14-18/h17-18H,5-14H2,1-4H3 |
| InChIKey | ULDZFCNXQRYRSI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol?
The IUPAC name of 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol (CID 10355999) is 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol.
What is the SMILES notation for 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol?
The canonical SMILES for 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol is CC(C)(CO)CCCCOCCCCC(C)(C)CO.
What is the InChIKey of 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol?
The InChIKey is ULDZFCNXQRYRSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O3/c1-15(2,13-17)9-5-7-11-19-12-8-6-10-16(3,4)14-18/h17-18H,5-14H2,1-4H3.
What are the key properties of 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol?
6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol has a molecular weight of 274.44 g/mol, XLogP of 3.38, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-hydroxy-5,5-dimethylhexoxy)-2,2-dimethylhexan-1-ol is sourced from PubChem (CID 10355999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).