C12H21NO6 — CID 10356016
[(1S,2S,5R,6R,7R,8S)-1,6,7-trihydroxy-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl] butanoate (PubChem CID 10356016) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is [(1S,2S,5R,6R,7R,8S)-1,6,7-trihydroxy-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl] butanoate.
| Compound Name | [(1S,2S,5R,6R,7R,8S)-1,6,7-trihydroxy-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl] butanoate |
|---|---|
| PubChem CID | 10356016 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | [(1S,2S,5R,6R,7R,8S)-1,6,7-trihydroxy-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1CN2[C@@H]([C@@H](O)[C@H](O)[C@H]2CO)[C@@H]1O |
| InChI | InChI=1S/C12H21NO6/c1-2-3-8(15)19-7-4-13-6(5-14)10(16)12(18)9(13)11(7)17/h6-7,9-12,14,16-18H,2-5H2,1H3/t6-,7+,9-,10-,11-,12-/m1/s1 |
| InChIKey | LHYCOPHDNSMUBY-NEKWJRAQSA-N |
| XLogP | -2.16 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |