C13H16Cl2O — CID 103564302
1-(2,5-dichlorophenyl)-3-propan-2-ylcyclobutan-1-ol (PubChem CID 103564302) has the molecular formula C13H16Cl2O and a molecular weight of 259.18 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-propan-2-ylcyclobutan-1-ol.
| Compound Name | 1-(2,5-dichlorophenyl)-3-propan-2-ylcyclobutan-1-ol |
|---|---|
| PubChem CID | 103564302 |
| Molecular Formula | C13H16Cl2O |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-propan-2-ylcyclobutan-1-ol |
| SMILES | CC(C)C1CC(O)(c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C13H16Cl2O/c1-8(2)9-6-13(16,7-9)11-5-10(14)3-4-12(11)15/h3-5,8-9,16H,6-7H2,1-2H3 |
| InChIKey | DHFGWFPYUIPOAO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |