C12H13F3O2 — CID 103564461
3-methyl-1-[2-(trifluoromethoxy)phenyl]cyclobutan-1-ol (PubChem CID 103564461) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-methyl-1-[2-(trifluoromethoxy)phenyl]cyclobutan-1-ol.
| Compound Name | 3-methyl-1-[2-(trifluoromethoxy)phenyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 103564461 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 3-methyl-1-[2-(trifluoromethoxy)phenyl]cyclobutan-1-ol |
| SMILES | CC1CC(O)(c2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C12H13F3O2/c1-8-6-11(16,7-8)9-4-2-3-5-10(9)17-12(13,14)15/h2-5,8,16H,6-7H2,1H3 |
| InChIKey | YDGOSTKQWKKPIG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |