C15H24O5 — CID 10356522
ethyl (Z)-3-[(2R,4R,5R)-2-tert-butyl-4,5-dimethyl-6-oxo-1,3-dioxan-5-yl]prop-2-enoate (PubChem CID 10356522) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is ethyl (Z)-3-[(2R,4R,5R)-2-tert-butyl-4,5-dimethyl-6-oxo-1,3-dioxan-5-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(2R,4R,5R)-2-tert-butyl-4,5-dimethyl-6-oxo-1,3-dioxan-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10356522 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | ethyl (Z)-3-[(2R,4R,5R)-2-tert-butyl-4,5-dimethyl-6-oxo-1,3-dioxan-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@@]1(C)C(=O)O[C@H](C(C)(C)C)O[C@@H]1C |
| InChI | InChI=1S/C15H24O5/c1-7-18-11(16)8-9-15(6)10(2)19-13(14(3,4)5)20-12(15)17/h8-10,13H,7H2,1-6H3/b9-8-/t10-,13-,15-/m1/s1 |
| InChIKey | POUGMFCVVCEBGA-VXVQJBCPSA-N |
| XLogP | 2.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|