About methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate
methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate (PubChem CID 10356582) has the molecular formula C15H15N3O3
and a molecular weight of 285.30 g/mol. Its IUPAC name is methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate |
| PubChem CID | 10356582 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate |
| SMILES | COC(=O)Cn1cnc2c(c1=O)CCNc1ccccc1-2 |
| InChI | InChI=1S/C15H15N3O3/c1-21-13(19)8-18-9-17-14-10-4-2-3-5-12(10)16-7-6-11(14)15(18)20/h2-5,9,16H,6-8H2,1H3 |
| InChIKey | CDGPDXPBXMQLEV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate?
The IUPAC name of methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate (CID 10356582) is methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate.
What is the SMILES notation for methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate?
The canonical SMILES for methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate is COC(=O)Cn1cnc2c(c1=O)CCNc1ccccc1-2.
What is the InChIKey of methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate?
The InChIKey is CDGPDXPBXMQLEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O3/c1-21-13(19)8-18-9-17-14-10-4-2-3-5-12(10)16-7-6-11(14)15(18)20/h2-5,9,16H,6-8H2,1H3.
What are the key properties of methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate?
methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate has a molecular weight of 285.30 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-oxo-6,7-dihydro-5H-pyrimido[5,4-d][1]benzazepin-3-yl)acetate is sourced from PubChem (CID 10356582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).