C18H22O3 — CID 10356666
methyl (8E,10E,12E,14R)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynoate (PubChem CID 10356666) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is methyl (8E,10E,12E,14R)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynoate.
| Compound Name | methyl (8E,10E,12E,14R)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynoate |
|---|---|
| PubChem CID | 10356666 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | methyl (8E,10E,12E,14R)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynoate |
| SMILES | CCC[C@@H](O)/C=C/C=C/C=C/C#CC#CCCC(=O)OC |
| InChI | InChI=1S/C18H22O3/c1-3-14-17(19)15-12-10-8-6-4-5-7-9-11-13-16-18(20)21-2/h4,6,8,10,12,15,17,19H,3,13-14,16H2,1-2H3/b6-4+,10-8+,15-12+/t17-/m1/s1 |
| InChIKey | LAOLXXZETVAKFQ-JNRDBWBESA-N |
| XLogP | 2.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|