C14H17N3O4 — CID 103566927
2-(3-cyano-5-methoxyphenoxy)-N-(ethylcarbamoyl)propanamide (PubChem CID 103566927) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-(3-cyano-5-methoxyphenoxy)-N-(ethylcarbamoyl)propanamide.
| Compound Name | 2-(3-cyano-5-methoxyphenoxy)-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 103566927 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-(3-cyano-5-methoxyphenoxy)-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)Oc1cc(C#N)cc(OC)c1 |
| InChI | InChI=1S/C14H17N3O4/c1-4-16-14(19)17-13(18)9(2)21-12-6-10(8-15)5-11(7-12)20-3/h5-7,9H,4H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | MYMOLEVRDHEOQT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |