C19H29NO — CID 10356728
3-[(3R,4R)-3,4-dimethyl-1-(4-methylpent-4-enyl)piperidin-4-yl]phenol (PubChem CID 10356728) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 3-[(3R,4R)-3,4-dimethyl-1-(4-methylpent-4-enyl)piperidin-4-yl]phenol.
| Compound Name | 3-[(3R,4R)-3,4-dimethyl-1-(4-methylpent-4-enyl)piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 10356728 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 3-[(3R,4R)-3,4-dimethyl-1-(4-methylpent-4-enyl)piperidin-4-yl]phenol |
| SMILES | C=C(C)CCCN1CC[C@@](C)(c2cccc(O)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C19H29NO/c1-15(2)7-6-11-20-12-10-19(4,16(3)14-20)17-8-5-9-18(21)13-17/h5,8-9,13,16,21H,1,6-7,10-12,14H2,2-4H3/t16-,19+/m0/s1 |
| InChIKey | ZUDHJLYIFCXWCE-QFBILLFUSA-N |
| XLogP | 4.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|