C14H28O4Si — CID 10356787
methyl (E,2R,3R)-7-[dimethyl(propan-2-yl)silyl]oxy-2-hydroxy-3-methylhept-4-enoate (PubChem CID 10356787) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is methyl (E,2R,3R)-7-[dimethyl(propan-2-yl)silyl]oxy-2-hydroxy-3-methylhept-4-enoate.
| Compound Name | methyl (E,2R,3R)-7-[dimethyl(propan-2-yl)silyl]oxy-2-hydroxy-3-methylhept-4-enoate |
|---|---|
| PubChem CID | 10356787 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | methyl (E,2R,3R)-7-[dimethyl(propan-2-yl)silyl]oxy-2-hydroxy-3-methylhept-4-enoate |
| SMILES | COC(=O)[C@H](O)[C@H](C)/C=C/CCO[Si](C)(C)C(C)C |
| InChI | InChI=1S/C14H28O4Si/c1-11(2)19(5,6)18-10-8-7-9-12(3)13(15)14(16)17-4/h7,9,11-13,15H,8,10H2,1-6H3/b9-7+/t12-,13-/m1/s1 |
| InChIKey | PKJCALNILYZHOV-SKFMMRCFSA-N |
| XLogP | 2.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|