C16H19NO4 — CID 10356814
[(3S,9R,9aS)-9-hydroxy-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl] benzoate (PubChem CID 10356814) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is [(3S,9R,9aS)-9-hydroxy-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl] benzoate.
| Compound Name | [(3S,9R,9aS)-9-hydroxy-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl] benzoate |
|---|---|
| PubChem CID | 10356814 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [(3S,9R,9aS)-9-hydroxy-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl] benzoate |
| SMILES | O=C(O[C@H]1CC[C@H]2[C@H](O)CCCN2C1=O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO4/c18-13-7-4-10-17-12(13)8-9-14(15(17)19)21-16(20)11-5-2-1-3-6-11/h1-3,5-6,12-14,18H,4,7-10H2/t12-,13+,14-/m0/s1 |
| InChIKey | ITNCOHTYWAAACD-MJBXVCDLSA-N |
| XLogP | 1.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |