About [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate
[(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate (PubChem CID 10356991) has the molecular formula C15H16O4S
and a molecular weight of 292.36 g/mol. Its IUPAC name is [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate |
| PubChem CID | 10356991 |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1=CC(=O)S[C@]1(C)Cc1ccccc1 |
| InChI | InChI=1S/C15H16O4S/c1-3-18-14(17)19-12-9-13(16)20-15(12,2)10-11-7-5-4-6-8-11/h4-9H,3,10H2,1-2H3/t15-/m1/s1 |
| InChIKey | BKHGOAQOQSETKH-OAHLLOKOSA-N |
| XLogP | 3.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate?
The IUPAC name of [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate (CID 10356991) is [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate.
What is the SMILES notation for [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate?
The canonical SMILES for [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate is CCOC(=O)OC1=CC(=O)S[C@]1(C)Cc1ccccc1.
What is the InChIKey of [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate?
The InChIKey is BKHGOAQOQSETKH-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H16O4S/c1-3-18-14(17)19-12-9-13(16)20-15(12,2)10-11-7-5-4-6-8-11/h4-9H,3,10H2,1-2H3/t15-/m1/s1.
What are the key properties of [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate?
[(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate has a molecular weight of 292.36 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-benzyl-2-methyl-5-oxothiophen-3-yl] ethyl carbonate is sourced from PubChem (CID 10356991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).