C13H14N4O — CID 103570351
2-(1-ethylpyrazol-4-yl)-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 103570351) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)-7,8-dihydro-6H-quinazolin-5-one.
| Compound Name | 2-(1-ethylpyrazol-4-yl)-7,8-dihydro-6H-quinazolin-5-one |
|---|---|
| PubChem CID | 103570351 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | CCn1cc(-c2ncc3c(n2)CCCC3=O)cn1 |
| InChI | InChI=1S/C13H14N4O/c1-2-17-8-9(6-15-17)13-14-7-10-11(16-13)4-3-5-12(10)18/h6-8H,2-5H2,1H3 |
| InChIKey | BGQNMUXUAPFMQT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |