C8H10N4S — CID 103570447
4-(1-ethylpyrazol-4-yl)-1,3-thiazol-5-amine (PubChem CID 103570447) has the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. Its IUPAC name is 4-(1-ethylpyrazol-4-yl)-1,3-thiazol-5-amine.
| Compound Name | 4-(1-ethylpyrazol-4-yl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 103570447 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 4-(1-ethylpyrazol-4-yl)-1,3-thiazol-5-amine |
| SMILES | CCn1cc(-c2ncsc2N)cn1 |
| InChI | InChI=1S/C8H10N4S/c1-2-12-4-6(3-11-12)7-8(9)13-5-10-7/h3-5H,2,9H2,1H3 |
| InChIKey | RUIZVIBLPZRGBQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |