C14H20IN5 — CID 103570534
N-ethyl-2-(1-ethylpyrazol-4-yl)-5-iodo-6-propylpyrimidin-4-amine (PubChem CID 103570534) has the molecular formula C14H20IN5 and a molecular weight of 385.25 g/mol. Its IUPAC name is N-ethyl-2-(1-ethylpyrazol-4-yl)-5-iodo-6-propylpyrimidin-4-amine.
| Compound Name | N-ethyl-2-(1-ethylpyrazol-4-yl)-5-iodo-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103570534 |
| Molecular Formula | C14H20IN5 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-ethyl-2-(1-ethylpyrazol-4-yl)-5-iodo-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(-c2cnn(CC)c2)nc(NCC)c1I |
| InChI | InChI=1S/C14H20IN5/c1-4-7-11-12(15)14(16-5-2)19-13(18-11)10-8-17-20(6-3)9-10/h8-9H,4-7H2,1-3H3,(H,16,18,19) |
| InChIKey | BXFTYXHVFKESLU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|