About 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine
3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine (PubChem CID 103571214) has the molecular formula C11H15F2N5
and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine.
Molecular Properties
| Compound Name | 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine |
| PubChem CID | 103571214 |
| Molecular Formula | C11H15F2N5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine |
| SMILES | CCn1cc(-c2cncn2CC(F)(F)CN)cn1 |
| InChI | InChI=1S/C11H15F2N5/c1-2-18-5-9(3-16-18)10-4-15-8-17(10)7-11(12,13)6-14/h3-5,8H,2,6-7,14H2,1H3 |
| InChIKey | IMJOINIRLCLHCZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine?
The IUPAC name of 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine (CID 103571214) is 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine.
What is the SMILES notation for 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine?
The canonical SMILES for 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine is CCn1cc(-c2cncn2CC(F)(F)CN)cn1.
What is the InChIKey of 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine?
The InChIKey is IMJOINIRLCLHCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2N5/c1-2-18-5-9(3-16-18)10-4-15-8-17(10)7-11(12,13)6-14/h3-5,8H,2,6-7,14H2,1H3.
What are the key properties of 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine?
3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine has a molecular weight of 255.27 g/mol, XLogP of 1.36, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(1-ethylpyrazol-4-yl)imidazol-1-yl]-2,2-difluoropropan-1-amine is sourced from PubChem (CID 103571214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).