About 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine
5-(2,2-diphenylethyl)-3,3-dimethylmorpholine (PubChem CID 10357167) has the molecular formula C20H25NO
and a molecular weight of 295.43 g/mol. Its IUPAC name is 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine.
Molecular Properties
| Compound Name | 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine |
| PubChem CID | 10357167 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine |
| SMILES | CC1(C)COCC(CC(c2ccccc2)c2ccccc2)N1 |
| InChI | InChI=1S/C20H25NO/c1-20(2)15-22-14-18(21-20)13-19(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18-19,21H,13-15H2,1-2H3 |
| InChIKey | XPVHEVDWXHDCHQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine?
The IUPAC name of 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine (CID 10357167) is 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine.
What is the SMILES notation for 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine?
The canonical SMILES for 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine is CC1(C)COCC(CC(c2ccccc2)c2ccccc2)N1.
What is the InChIKey of 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine?
The InChIKey is XPVHEVDWXHDCHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO/c1-20(2)15-22-14-18(21-20)13-19(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18-19,21H,13-15H2,1-2H3.
What are the key properties of 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine?
5-(2,2-diphenylethyl)-3,3-dimethylmorpholine has a molecular weight of 295.43 g/mol, XLogP of 3.98, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-diphenylethyl)-3,3-dimethylmorpholine is sourced from PubChem (CID 10357167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).