C17H10F2N2O — CID 10357189
5-(3,5-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 10357189) has the molecular formula C17H10F2N2O and a molecular weight of 296.28 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(3,5-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 10357189 |
| Molecular Formula | C17H10F2N2O |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-(3,5-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Fc1cc(F)cc(-c2cnc3[nH]cc(-c4ccoc4)c3c2)c1 |
| InChI | InChI=1S/C17H10F2N2O/c18-13-3-11(4-14(19)6-13)12-5-15-16(10-1-2-22-9-10)8-21-17(15)20-7-12/h1-9H,(H,20,21) |
| InChIKey | USGARASJVPKKOW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |