About 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine
5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 10357190) has the molecular formula C17H10F2N2O
and a molecular weight of 296.28 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 10357190 |
| Molecular Formula | C17H10F2N2O |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Fc1ccc(-c2cnc3[nH]cc(-c4ccoc4)c3c2)cc1F |
| InChI | InChI=1S/C17H10F2N2O/c18-15-2-1-10(6-16(15)19)12-5-13-14(11-3-4-22-9-11)8-21-17(13)20-7-12/h1-9H,(H,20,21) |
| InChIKey | HXDFPICLPMWXQF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine (CID 10357190) is 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine is Fc1ccc(-c2cnc3[nH]cc(-c4ccoc4)c3c2)cc1F.
What is the InChIKey of 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is HXDFPICLPMWXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F2N2O/c18-15-2-1-10(6-16(15)19)12-5-13-14(11-3-4-22-9-11)8-21-17(13)20-7-12/h1-9H,(H,20,21).
What are the key properties of 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine?
5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 296.28 g/mol, XLogP of 4.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-difluorophenyl)-3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 10357190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).