C16H22N2O — CID 103572665
2-(2,6-dimethylphenyl)-1-(1-propylpyrazol-4-yl)ethanol (PubChem CID 103572665) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-1-(1-propylpyrazol-4-yl)ethanol.
| Compound Name | 2-(2,6-dimethylphenyl)-1-(1-propylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 103572665 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-1-(1-propylpyrazol-4-yl)ethanol |
| SMILES | CCCn1cc(C(O)Cc2c(C)cccc2C)cn1 |
| InChI | InChI=1S/C16H22N2O/c1-4-8-18-11-14(10-17-18)16(19)9-15-12(2)6-5-7-13(15)3/h5-7,10-11,16,19H,4,8-9H2,1-3H3 |
| InChIKey | WKOKGZNZBJGCJP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |