C8H8FNaO4S — CID 103574292
sodium (4-fluoro-2-methylphenyl)-hydroxymethanesulfonate (PubChem CID 103574292) has the molecular formula C8H8FNaO4S and a molecular weight of 242.20 g/mol. Its IUPAC name is sodium (4-fluoro-2-methylphenyl)-hydroxymethanesulfonate.
| Compound Name | sodium (4-fluoro-2-methylphenyl)-hydroxymethanesulfonate |
|---|---|
| PubChem CID | 103574292 |
| Molecular Formula | C8H8FNaO4S |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | sodium (4-fluoro-2-methylphenyl)-hydroxymethanesulfonate |
| SMILES | Cc1cc(F)ccc1C(O)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H9FO4S.Na/c1-5-4-6(9)2-3-7(5)8(10)14(11,12)13;/h2-4,8,10H,1H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | UNDMHJSZRYEAIG-UHFFFAOYSA-M |
| XLogP | -2.33 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|