C6H11NaO4S — CID 103574475
sodium 1-hydroxy-2-methylcyclopentane-1-sulfonate (PubChem CID 103574475) has the molecular formula C6H11NaO4S and a molecular weight of 202.21 g/mol. Its IUPAC name is sodium 1-hydroxy-2-methylcyclopentane-1-sulfonate.
| Compound Name | sodium 1-hydroxy-2-methylcyclopentane-1-sulfonate |
|---|---|
| PubChem CID | 103574475 |
| Molecular Formula | C6H11NaO4S |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | sodium 1-hydroxy-2-methylcyclopentane-1-sulfonate |
| SMILES | CC1CCCC1(O)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H12O4S.Na/c1-5-3-2-4-6(5,7)11(8,9)10;/h5,7H,2-4H2,1H3,(H,8,9,10);/q;+1/p-1 |
| InChIKey | PFSFAFXKKCQHLA-UHFFFAOYSA-M |
| XLogP | -2.96 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|