C12H16NNaO4S — CID 103574532
sodium 1-benzyl-3-hydroxypiperidine-3-sulfonate (PubChem CID 103574532) has the molecular formula C12H16NNaO4S and a molecular weight of 293.32 g/mol. Its IUPAC name is sodium 1-benzyl-3-hydroxypiperidine-3-sulfonate.
| Compound Name | sodium 1-benzyl-3-hydroxypiperidine-3-sulfonate |
|---|---|
| PubChem CID | 103574532 |
| Molecular Formula | C12H16NNaO4S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | sodium 1-benzyl-3-hydroxypiperidine-3-sulfonate |
| SMILES | O=S(=O)([O-])C1(O)CCCN(Cc2ccccc2)C1.[Na+] |
| InChI | InChI=1S/C12H17NO4S.Na/c14-12(18(15,16)17)7-4-8-13(10-12)9-11-5-2-1-3-6-11;/h1-3,5-6,14H,4,7-10H2,(H,15,16,17);/q;+1/p-1 |
| InChIKey | YETDQQWZYVCQDZ-UHFFFAOYSA-M |
| XLogP | -2.48 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|