C11H16F2O3 — CID 103574641
ethyl 1-(2,2-difluoroethyl)-2-oxocyclohexane-1-carboxylate (PubChem CID 103574641) has the molecular formula C11H16F2O3 and a molecular weight of 234.24 g/mol. Its IUPAC name is ethyl 1-(2,2-difluoroethyl)-2-oxocyclohexane-1-carboxylate.
| Compound Name | ethyl 1-(2,2-difluoroethyl)-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 103574641 |
| Molecular Formula | C11H16F2O3 |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | ethyl 1-(2,2-difluoroethyl)-2-oxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(CC(F)F)CCCCC1=O |
| InChI | InChI=1S/C11H16F2O3/c1-2-16-10(15)11(7-9(12)13)6-4-3-5-8(11)14/h9H,2-7H2,1H3 |
| InChIKey | JCRACOKJCKITDJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|