C11H18N2O — CID 103575621
1-[1-(furan-3-yl)ethyl]-4-methylpyrrolidin-3-amine (PubChem CID 103575621) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-[1-(furan-3-yl)ethyl]-4-methylpyrrolidin-3-amine.
| Compound Name | 1-[1-(furan-3-yl)ethyl]-4-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 103575621 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-[1-(furan-3-yl)ethyl]-4-methylpyrrolidin-3-amine |
| SMILES | CC1CN(C(C)c2ccoc2)CC1N |
| InChI | InChI=1S/C11H18N2O/c1-8-5-13(6-11(8)12)9(2)10-3-4-14-7-10/h3-4,7-9,11H,5-6,12H2,1-2H3 |
| InChIKey | UXKIXSFMPVMXMR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |